Information card for entry 2000183
| Formula |
C18 H26 O12 |
| Calculated formula |
C18 H26 O12 |
| SMILES |
CC(=O)O[C@@H]([C@@H]([C@@H](OC(=O)C)COC(=O)C)OC(=O)C)[C@H](OC(=O)C)COC(=O)C |
| Title of publication |
Structure of 1,2,3,4,5,6-hexa-<i>O</i>-acetyl-<small>D</small>-glucitol (sorbitol hexaacetate) |
| Authors of publication |
Kopf, J.; Topf, C.; Morf, M.; Zimmer, B.; Köll, P. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1991 |
| Journal volume |
47 |
| Journal issue |
11 |
| Pages of publication |
2425 - 2428 |
| a |
10.251 ± 0.001 Å |
| b |
8.37 ± 0.001 Å |
| c |
12.548 ± 0.001 Å |
| α |
90° |
| β |
95.98 ± 0.05° |
| γ |
90° |
| Cell volume |
1070.8 ± 0.2 Å3 |
| Number of distinct elements |
3 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Diffraction radiation wavelength |
0.70926 Å |
| Diffraction radiation type |
Mo |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
Version history
Version history is temporarily not available due to server issues.
