Information card for entry 2002067
| Formula |
C13 H15 N O |
| Calculated formula |
C13 H15 N O |
| SMILES |
N1C(=O)C[C@H]2C[C@H](c3c(ccc1c23)C)C.N1C(=O)C[C@@H]2C[C@@H](c3c(ccc1c23)C)C |
| Title of publication |
Structure of 1,8-dimethyl-4-oxo-1,2,2a,3,4,5-hexahydrocyclopenta[<i>de</i>]quinoline |
| Authors of publication |
Sekar, K.; Parthasarathy, S.; Prabahar, K. J.; Ramakrishnan, V. T. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1993 |
| Journal volume |
49 |
| Journal issue |
1 |
| Pages of publication |
97 - 99 |
| a |
8.929 ± 0.002 Å |
| b |
8.99 ± 0.002 Å |
| c |
8.094 ± 0.002 Å |
| α |
103.79 ± 0.02° |
| β |
116.71 ± 0.02° |
| γ |
67.86 ± 0.02° |
| Cell volume |
535.7 ± 0.2 Å3 |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
Cu |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
Version history
Version history is temporarily not available due to server issues.
