Information card for entry 2101191
| Formula |
C20 H22 O4 |
| Calculated formula |
C20 H22 O4 |
| SMILES |
COC(=O)C1=C(C(=O)OC)[C@@]2(C)C=C[C@]1(C)c1c2c(C)ccc1C |
| Title of publication |
Crystal structure and photochemistry of dimethyl 1,4-dihydro-1,4,5,8-tetramethyl-1,4-ethenonaphthalene-2,3-dicarboxylate |
| Authors of publication |
Jones, R.; Scheffer, J. R.; Trotter, J.; Yap, M. |
| Journal of publication |
Acta Crystallographica Section B |
| Year of publication |
1994 |
| Journal volume |
50 |
| Journal issue |
5 |
| Pages of publication |
597 - 600 |
| a |
12.643 ± 0.001 Å |
| b |
9.288 ± 0.001 Å |
| c |
15.153 ± 0.001 Å |
| α |
90° |
| β |
105.7 ± 0.01° |
| γ |
90° |
| Cell volume |
1713 ± 0.3 Å3 |
| Number of distinct elements |
3 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
Cu |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
Version history
Version history is temporarily not available due to server issues.
