Information card for entry 2200032
No preview available: file is not found.
| Chemical name |
11H-Pyridinium[2,3h]-7,8,9,10-tetrahydrocarbazole chloride |
| Formula |
C15 H15 Cl N2 |
| Calculated formula |
C15 H15 Cl N2 |
| SMILES |
[Cl-].[nH+]1cccc2ccc3c4CCCCc4[nH]c3c12 |
| Title of publication |
7,8,9,10-Tetrahydro-11<i>H</i>-pyrido[2,3-<i>a</i>]carbazol-1-ium chloride |
| Authors of publication |
Lynch, Daniel E.; McClenaghan, Ian |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2001 |
| Journal volume |
57 |
| Journal issue |
1 |
| Pages of publication |
o43 - o44 |
| a |
15.9111 ± 0.0006 Å |
| b |
5.0374 ± 0.0002 Å |
| c |
17.1233 ± 0.0009 Å |
| α |
90° |
| β |
113.933 ± 0.0017° |
| γ |
90° |
| Cell volume |
1254.44 ± 0.1 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.102 |
| Residual factor for significantly intense reflections |
0.048 |
| Weighted residual factors for all reflections included in the refinement |
0.105 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.99 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
Version history
Version history is temporarily not available due to server issues.