Information card for entry 2214217
No preview available: file is not found.
| Chemical name |
3-Benzoyl-4-methyl-5,6,7-tetrahydro-1,2,3-triazolo[1,5-a]pyrimidine |
| Formula |
C13 H14 N4 O |
| Calculated formula |
C13 H14 N4 O |
| SMILES |
O=C(c1nnn2CCCN(C)c12)c1ccccc1 |
| Title of publication |
3-Benzoyl-4-methyl-4,5,6,7-tetrahydro-1,2,3-triazolo[1,5-<i>a</i>]pyrimidine |
| Authors of publication |
Chu-Yi Yu; Xue-Ning Yuan; Zhi-Tang Huang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
7 |
| Pages of publication |
o3078 - o3078 |
| a |
14.644 ± 0.005 Å |
| b |
7.597 ± 0.003 Å |
| c |
22.711 ± 0.008 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2526.6 ± 1.6 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0826 |
| Residual factor for significantly intense reflections |
0.0407 |
| Weighted residual factors for significantly intense reflections |
0.0963 |
| Weighted residual factors for all reflections included in the refinement |
0.1155 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.013 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
Version history
Version history is temporarily not available due to server issues.
